C14H22N4O3 — CID 51079392
tert-butyl 2-[(1-methylpyrazol-4-yl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 51079392) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is tert-butyl 2-[(1-methylpyrazol-4-yl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(1-methylpyrazol-4-yl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 51079392 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | tert-butyl 2-[(1-methylpyrazol-4-yl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | Cn1cc(NC(=O)C2CCCN2C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C14H22N4O3/c1-14(2,3)21-13(20)18-7-5-6-11(18)12(19)16-10-8-15-17(4)9-10/h8-9,11H,5-7H2,1-4H3,(H,16,19) |
| InChIKey | JVJILJIPERRPPW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |