C15H23FN2O3S — CID 51080633
2-[(4-fluorophenyl)methylsulfonylamino]-N,N,4-trimethylpentanamide (PubChem CID 51080633) has the molecular formula C15H23FN2O3S and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfonylamino]-N,N,4-trimethylpentanamide.
| Compound Name | 2-[(4-fluorophenyl)methylsulfonylamino]-N,N,4-trimethylpentanamide |
|---|---|
| PubChem CID | 51080633 |
| Molecular Formula | C15H23FN2O3S |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfonylamino]-N,N,4-trimethylpentanamide |
| SMILES | CC(C)CC(NS(=O)(=O)Cc1ccc(F)cc1)C(=O)N(C)C |
| InChI | InChI=1S/C15H23FN2O3S/c1-11(2)9-14(15(19)18(3)4)17-22(20,21)10-12-5-7-13(16)8-6-12/h5-8,11,14,17H,9-10H2,1-4H3 |
| InChIKey | NQUTWEZBFGPIOP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |