C18H19N5O2 — CID 51092114
N-[2-(3,5-dimethylphenoxy)ethyl]-2-(1,2,4-triazol-1-yl)pyridine-3-carboxamide (PubChem CID 51092114) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-2-(1,2,4-triazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2-(1,2,4-triazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51092114 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2-(1,2,4-triazol-1-yl)pyridine-3-carboxamide |
| SMILES | Cc1cc(C)cc(OCCNC(=O)c2cccnc2-n2cncn2)c1 |
| InChI | InChI=1S/C18H19N5O2/c1-13-8-14(2)10-15(9-13)25-7-6-21-18(24)16-4-3-5-20-17(16)23-12-19-11-22-23/h3-5,8-12H,6-7H2,1-2H3,(H,21,24) |
| InChIKey | WQHSZPROIAZXGG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|