C17H21N3O2S — CID 51093568
2-(4-oxo-1,3-thiazolidin-3-yl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]acetamide (PubChem CID 51093568) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-(4-oxo-1,3-thiazolidin-3-yl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]acetamide.
| Compound Name | 2-(4-oxo-1,3-thiazolidin-3-yl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]acetamide |
|---|---|
| PubChem CID | 51093568 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(4-oxo-1,3-thiazolidin-3-yl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]acetamide |
| SMILES | Cc1cc(CNC(=O)CN2CSCC2=O)c2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C17H21N3O2S/c1-10-4-13(17-14(5-10)11(2)12(3)19-17)6-18-15(21)7-20-9-23-8-16(20)22/h4-5,19H,6-9H2,1-3H3,(H,18,21) |
| InChIKey | JQSCYFPXEWQQKN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|