C22H26N2O3 — CID 56878946
2-(3,4-dimethoxyphenyl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]acetamide (PubChem CID 56878946) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]acetamide |
|---|---|
| PubChem CID | 56878946 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCc2cc(C)cc3c(C)c(C)[nH]c23)cc1OC |
| InChI | InChI=1S/C22H26N2O3/c1-13-8-17(22-18(9-13)14(2)15(3)24-22)12-23-21(25)11-16-6-7-19(26-4)20(10-16)27-5/h6-10,24H,11-12H2,1-5H3,(H,23,25) |
| InChIKey | KAQJKGSSBRHIOX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|