C18H21N2O5S- — CID 174837834
1,2-dimethoxy-4-[2-[[2-[methyl(sulfinato)amino]phenyl]methylamino]-2-oxoethyl]benzene (PubChem CID 174837834) has the molecular formula C18H21N2O5S- and a molecular weight of 377.44 g/mol. Its IUPAC name is 1,2-dimethoxy-4-[2-[[2-[methyl(sulfinato)amino]phenyl]methylamino]-2-oxoethyl]benzene.
| Compound Name | 1,2-dimethoxy-4-[2-[[2-[methyl(sulfinato)amino]phenyl]methylamino]-2-oxoethyl]benzene |
|---|---|
| PubChem CID | 174837834 |
| Molecular Formula | C18H21N2O5S- |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1,2-dimethoxy-4-[2-[[2-[methyl(sulfinato)amino]phenyl]methylamino]-2-oxoethyl]benzene |
| SMILES | COc1ccc(CC(=O)NCc2ccccc2N(C)S(=O)[O-])cc1OC |
| InChI | InChI=1S/C18H22N2O5S/c1-20(26(22)23)15-7-5-4-6-14(15)12-19-18(21)11-13-8-9-16(24-2)17(10-13)25-3/h4-10H,11-12H2,1-3H3,(H,19,21)(H,22,23)/p-1 |
| InChIKey | FFJTXULLFNKATA-UHFFFAOYSA-M |
| XLogP | 1.79 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|