C21H23N5O — CID 51126213
1-ethyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]benzotriazole-5-carboxamide (PubChem CID 51126213) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-ethyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 51126213 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-ethyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]benzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)NCc3cc(C)cc4c(C)c(C)[nH]c34)ccc21 |
| InChI | InChI=1S/C21H23N5O/c1-5-26-19-7-6-15(10-18(19)24-25-26)21(27)22-11-16-8-12(2)9-17-13(3)14(4)23-20(16)17/h6-10,23H,5,11H2,1-4H3,(H,22,27) |
| InChIKey | GKJHJBPRTSVQMH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|