C21H22N6O — CID 56862452
4-(tetrazol-1-ylmethyl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]benzamide (PubChem CID 56862452) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is 4-(tetrazol-1-ylmethyl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]benzamide.
| Compound Name | 4-(tetrazol-1-ylmethyl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]benzamide |
|---|---|
| PubChem CID | 56862452 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 4-(tetrazol-1-ylmethyl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]benzamide |
| SMILES | Cc1cc(CNC(=O)c2ccc(Cn3cnnn3)cc2)c2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C21H22N6O/c1-13-8-18(20-19(9-13)14(2)15(3)24-20)10-22-21(28)17-6-4-16(5-7-17)11-27-12-23-25-26-27/h4-9,12,24H,10-11H2,1-3H3,(H,22,28) |
| InChIKey | CDOOZDVRMGTOHV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|