C19H23N3O2 — CID 56875403
2-ethyl-4-methyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]-1,3-oxazole-5-carboxamide (PubChem CID 56875403) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-ethyl-4-methyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]-1,3-oxazole-5-carboxamide.
| Compound Name | 2-ethyl-4-methyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 56875403 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-ethyl-4-methyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]-1,3-oxazole-5-carboxamide |
| SMILES | CCc1nc(C)c(C(=O)NCc2cc(C)cc3c(C)c(C)[nH]c23)o1 |
| InChI | InChI=1S/C19H23N3O2/c1-6-16-21-13(5)18(24-16)19(23)20-9-14-7-10(2)8-15-11(3)12(4)22-17(14)15/h7-8,22H,6,9H2,1-5H3,(H,20,23) |
| InChIKey | IHMAMLWWSDELIF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|