C12H22ClN7 — CID 51105352
N,N,1,3-tetramethyl-4-[[2-(1,2,4-triazol-1-yl)ethylamino]methyl]pyrazol-5-amine;hydrochloride (PubChem CID 51105352) has the molecular formula C12H22ClN7 and a molecular weight of 299.81 g/mol. Its IUPAC name is N,N,1,3-tetramethyl-4-[[2-(1,2,4-triazol-1-yl)ethylamino]methyl]pyrazol-5-amine;hydrochloride.
| Compound Name | N,N,1,3-tetramethyl-4-[[2-(1,2,4-triazol-1-yl)ethylamino]methyl]pyrazol-5-amine;hydrochloride |
|---|---|
| PubChem CID | 51105352 |
| Molecular Formula | C12H22ClN7 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N,N,1,3-tetramethyl-4-[[2-(1,2,4-triazol-1-yl)ethylamino]methyl]pyrazol-5-amine;hydrochloride |
| SMILES | Cc1nn(C)c(N(C)C)c1CNCCn1cncn1.Cl |
| InChI | InChI=1S/C12H21N7.ClH/c1-10-11(12(17(2)3)18(4)16-10)7-13-5-6-19-9-14-8-15-19;/h8-9,13H,5-7H2,1-4H3;1H |
| InChIKey | BTTXTNWUJJXUEF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|