C15H20N4O4 — CID 51109269
N'-[2-[(2-ethoxy-4-pyridinyl)methylamino]-2-oxoethyl]-N-prop-2-enyloxamide (PubChem CID 51109269) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is N'-[2-[(2-ethoxy-4-pyridinyl)methylamino]-2-oxoethyl]-N-prop-2-enyloxamide.
| Compound Name | N'-[2-[(2-ethoxy-4-pyridinyl)methylamino]-2-oxoethyl]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 51109269 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N'-[2-[(2-ethoxy-4-pyridinyl)methylamino]-2-oxoethyl]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCC(=O)NCc1ccnc(OCC)c1 |
| InChI | InChI=1S/C15H20N4O4/c1-3-6-17-14(21)15(22)19-10-12(20)18-9-11-5-7-16-13(8-11)23-4-2/h3,5,7-8H,1,4,6,9-10H2,2H3,(H,17,21)(H,18,20)(H,19,22) |
| InChIKey | NDAWRUPGZVTQHS-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|