C19H20N4O3 — CID 51113442
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 1-pyrimidin-2-ylpiperidine-3-carboxylate (PubChem CID 51113442) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 1-pyrimidin-2-ylpiperidine-3-carboxylate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 1-pyrimidin-2-ylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 51113442 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 1-pyrimidin-2-ylpiperidine-3-carboxylate |
| SMILES | O=C1CCc2cc(OC(=O)C3CCCN(c4ncccn4)C3)ccc2N1 |
| InChI | InChI=1S/C19H20N4O3/c24-17-7-4-13-11-15(5-6-16(13)22-17)26-18(25)14-3-1-10-23(12-14)19-20-8-2-9-21-19/h2,5-6,8-9,11,14H,1,3-4,7,10,12H2,(H,22,24) |
| InChIKey | SWFXXOXCOWCYTI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|