C21H19ClF3N3O3 — CID 55516736
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylate (PubChem CID 55516736) has the molecular formula C21H19ClF3N3O3 and a molecular weight of 453.85 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55516736 |
| Molecular Formula | C21H19ClF3N3O3 |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylate |
| SMILES | O=C1CCc2cc(OC(=O)C3CCN(c4ncc(C(F)(F)F)cc4Cl)CC3)ccc2N1 |
| InChI | InChI=1S/C21H19ClF3N3O3/c22-16-10-14(21(23,24)25)11-26-19(16)28-7-5-12(6-8-28)20(30)31-15-2-3-17-13(9-15)1-4-18(29)27-17/h2-3,9-12H,1,4-8H2,(H,27,29) |
| InChIKey | TUZCKCGVIBKBOD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|