C19H25NOS — CID 51119626
1-[3-(2-phenylethoxy)propyl]-2-thiophen-3-ylpyrrolidine (PubChem CID 51119626) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is 1-[3-(2-phenylethoxy)propyl]-2-thiophen-3-ylpyrrolidine.
| Compound Name | 1-[3-(2-phenylethoxy)propyl]-2-thiophen-3-ylpyrrolidine |
|---|---|
| PubChem CID | 51119626 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-[3-(2-phenylethoxy)propyl]-2-thiophen-3-ylpyrrolidine |
| SMILES | c1ccc(CCOCCCN2CCCC2c2ccsc2)cc1 |
| InChI | InChI=1S/C19H25NOS/c1-2-6-17(7-3-1)9-14-21-13-5-12-20-11-4-8-19(20)18-10-15-22-16-18/h1-3,6-7,10,15-16,19H,4-5,8-9,11-14H2 |
| InChIKey | GHQDUPVUXVQIIF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|