C18H25F3N2O2 — CID 51120238
N-[2-(2,6-dimethylphenoxy)ethyl]-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide (PubChem CID 51120238) has the molecular formula C18H25F3N2O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-[2-(2,6-dimethylphenoxy)ethyl]-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(2,6-dimethylphenoxy)ethyl]-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51120238 |
| Molecular Formula | C18H25F3N2O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[2-(2,6-dimethylphenoxy)ethyl]-1-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
| SMILES | Cc1cccc(C)c1OCCNC(=O)C1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H25F3N2O2/c1-13-4-3-5-14(2)16(13)25-11-8-22-17(24)15-6-9-23(10-7-15)12-18(19,20)21/h3-5,15H,6-12H2,1-2H3,(H,22,24) |
| InChIKey | ZGKREHYNDDBMLB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|