C24H20N4O2S — CID 51120346
N-(5-benzamido-2-methylphenyl)-4-(2-sulfanylidene-1H-imidazol-3-yl)benzamide (PubChem CID 51120346) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is N-(5-benzamido-2-methylphenyl)-4-(2-sulfanylidene-1H-imidazol-3-yl)benzamide.
| Compound Name | N-(5-benzamido-2-methylphenyl)-4-(2-sulfanylidene-1H-imidazol-3-yl)benzamide |
|---|---|
| PubChem CID | 51120346 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-(5-benzamido-2-methylphenyl)-4-(2-sulfanylidene-1H-imidazol-3-yl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2)cc1NC(=O)c1ccc(-n2cc[nH]c2=S)cc1 |
| InChI | InChI=1S/C24H20N4O2S/c1-16-7-10-19(26-22(29)17-5-3-2-4-6-17)15-21(16)27-23(30)18-8-11-20(12-9-18)28-14-13-25-24(28)31/h2-15H,1H3,(H,25,31)(H,26,29)(H,27,30) |
| InChIKey | RCTHHRLFTYOTLR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|