C16H12N6OS — CID 38781994
N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]-2H-benzotriazole-5-carboxamide (PubChem CID 38781994) has the molecular formula C16H12N6OS and a molecular weight of 336.38 g/mol. Its IUPAC name is N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 38781994 |
| Molecular Formula | C16H12N6OS |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]-2H-benzotriazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(-n2cc[nH]c2=S)c1)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C16H12N6OS/c23-15(10-4-5-13-14(8-10)20-21-19-13)18-11-2-1-3-12(9-11)22-7-6-17-16(22)24/h1-9H,(H,17,24)(H,18,23)(H,19,20,21) |
| InChIKey | JUIRWTGFBPCAKL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|