C32H27N5OS — CID 20618707
3-[(2-carbazol-9-ylcyclopropyl)-methylamino]-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]benzamide (PubChem CID 20618707) has the molecular formula C32H27N5OS and a molecular weight of 529.67 g/mol. Its IUPAC name is 3-[(2-carbazol-9-ylcyclopropyl)-methylamino]-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]benzamide.
| Compound Name | 3-[(2-carbazol-9-ylcyclopropyl)-methylamino]-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 20618707 |
| Molecular Formula | C32H27N5OS |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 3-[(2-carbazol-9-ylcyclopropyl)-methylamino]-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]benzamide |
| SMILES | CN(c1cccc(C(=O)Nc2cccc(-n3cc[nH]c3=S)c2)c1)C1CC1n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C32H27N5OS/c1-35(29-20-30(29)37-27-14-4-2-12-25(27)26-13-3-5-15-28(26)37)23-10-6-8-21(18-23)31(38)34-22-9-7-11-24(19-22)36-17-16-33-32(36)39/h2-19,29-30H,20H2,1H3,(H,33,39)(H,34,38) |
| InChIKey | XUEVZVHUSMWJFZ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|