C17H17N3O3S — CID 51101260
4,5,5-trimethyl-2-oxo-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]furan-3-carboxamide (PubChem CID 51101260) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4,5,5-trimethyl-2-oxo-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]furan-3-carboxamide.
| Compound Name | 4,5,5-trimethyl-2-oxo-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 51101260 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 4,5,5-trimethyl-2-oxo-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]furan-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(-n3cc[nH]c3=S)c2)C(=O)OC1(C)C |
| InChI | InChI=1S/C17H17N3O3S/c1-10-13(15(22)23-17(10,2)3)14(21)19-11-5-4-6-12(9-11)20-8-7-18-16(20)24/h4-9H,1-3H3,(H,18,24)(H,19,21) |
| InChIKey | NVFNDKZMXBSPJQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|