C17H20N3S+ — CID 5112280
5-benzyl-1-(3-methylphenyl)-1,3,5-triazinan-5-ium-2-thione (PubChem CID 5112280) has the molecular formula C17H20N3S+ and a molecular weight of 298.44 g/mol. Its IUPAC name is 5-benzyl-1-(3-methylphenyl)-1,3,5-triazinan-5-ium-2-thione.
| Compound Name | 5-benzyl-1-(3-methylphenyl)-1,3,5-triazinan-5-ium-2-thione |
|---|---|
| PubChem CID | 5112280 |
| Molecular Formula | C17H20N3S+ |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-benzyl-1-(3-methylphenyl)-1,3,5-triazinan-5-ium-2-thione |
| SMILES | Cc1cccc(N2C[NH+](Cc3ccccc3)CNC2=S)c1 |
| InChI | InChI=1S/C17H19N3S/c1-14-6-5-9-16(10-14)20-13-19(12-18-17(20)21)11-15-7-3-2-4-8-15/h2-10H,11-13H2,1H3,(H,18,21)/p+1 |
| InChIKey | BDGAQGMTWYEKPX-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|