C17H16F3N3S — CID 16763879
5-benzyl-1-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2-thione (PubChem CID 16763879) has the molecular formula C17H16F3N3S and a molecular weight of 351.40 g/mol. Its IUPAC name is 5-benzyl-1-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2-thione.
| Compound Name | 5-benzyl-1-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 16763879 |
| Molecular Formula | C17H16F3N3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 5-benzyl-1-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2-thione |
| SMILES | FC(F)(F)c1cccc(N2CN(Cc3ccccc3)CNC2=S)c1 |
| InChI | InChI=1S/C17H16F3N3S/c18-17(19,20)14-7-4-8-15(9-14)23-12-22(11-21-16(23)24)10-13-5-2-1-3-6-13/h1-9H,10-12H2,(H,21,24) |
| InChIKey | BWPCCIRONFZHCH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|