C14H18F3N3S — CID 42587355
5-[(2R)-butan-2-yl]-1-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2-thione (PubChem CID 42587355) has the molecular formula C14H18F3N3S and a molecular weight of 317.38 g/mol. Its IUPAC name is 5-[(2R)-butan-2-yl]-1-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2-thione.
| Compound Name | 5-[(2R)-butan-2-yl]-1-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 42587355 |
| Molecular Formula | C14H18F3N3S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 5-[(2R)-butan-2-yl]-1-[3-(trifluoromethyl)phenyl]-1,3,5-triazinane-2-thione |
| SMILES | CC[C@@H](C)N1CNC(=S)N(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H18F3N3S/c1-3-10(2)19-8-18-13(21)20(9-19)12-6-4-5-11(7-12)14(15,16)17/h4-7,10H,3,8-9H2,1-2H3,(H,18,21)/t10-/m1/s1 |
| InChIKey | IEVNXCJTYBODQO-SNVBAGLBSA-N |
| XLogP | 3.42 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|