C18H25N3O4S — CID 51126448
N-methyl-1-[2-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperidine-2-carboxamide (PubChem CID 51126448) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-methyl-1-[2-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperidine-2-carboxamide.
| Compound Name | N-methyl-1-[2-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 51126448 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-methyl-1-[2-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCCN1S(=O)(=O)c1ccc(N2CCCC2=O)cc1C |
| InChI | InChI=1S/C18H25N3O4S/c1-13-12-14(20-10-5-7-17(20)22)8-9-16(13)26(24,25)21-11-4-3-6-15(21)18(23)19-2/h8-9,12,15H,3-7,10-11H2,1-2H3,(H,19,23) |
| InChIKey | XKPJLZORZDZQEL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |