C17H26N2O3S2 — CID 51128592
N-[1-(4-ethylsulfonylphenyl)piperidin-4-yl]-2-methylsulfanylpropanamide (PubChem CID 51128592) has the molecular formula C17H26N2O3S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is N-[1-(4-ethylsulfonylphenyl)piperidin-4-yl]-2-methylsulfanylpropanamide.
| Compound Name | N-[1-(4-ethylsulfonylphenyl)piperidin-4-yl]-2-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 51128592 |
| Molecular Formula | C17H26N2O3S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[1-(4-ethylsulfonylphenyl)piperidin-4-yl]-2-methylsulfanylpropanamide |
| SMILES | CCS(=O)(=O)c1ccc(N2CCC(NC(=O)C(C)SC)CC2)cc1 |
| InChI | InChI=1S/C17H26N2O3S2/c1-4-24(21,22)16-7-5-15(6-8-16)19-11-9-14(10-12-19)18-17(20)13(2)23-3/h5-8,13-14H,4,9-12H2,1-3H3,(H,18,20) |
| InChIKey | GWAYDAVDLFLQBX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |