C18H14N4O3 — CID 51128607
1H-indazol-4-yl 4-methoxy-1-phenylpyrazole-3-carboxylate (PubChem CID 51128607) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 1H-indazol-4-yl 4-methoxy-1-phenylpyrazole-3-carboxylate.
| Compound Name | 1H-indazol-4-yl 4-methoxy-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 51128607 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1H-indazol-4-yl 4-methoxy-1-phenylpyrazole-3-carboxylate |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)Oc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C18H14N4O3/c1-24-16-11-22(12-6-3-2-4-7-12)21-17(16)18(23)25-15-9-5-8-14-13(15)10-19-20-14/h2-11H,1H3,(H,19,20) |
| InChIKey | XWDVWSSDTMRVNJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|