C24H30N4O4S — CID 5113322
4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 5113322) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is 4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 5113322 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | COc1ccc(N2CCN(C(=O)CC(C)(C)CC3=NS(=O)(=O)c4ccccc4N3)CC2)cc1 |
| InChI | InChI=1S/C24H30N4O4S/c1-24(2,16-22-25-20-6-4-5-7-21(20)33(30,31)26-22)17-23(29)28-14-12-27(13-15-28)18-8-10-19(32-3)11-9-18/h4-11H,12-17H2,1-3H3,(H,25,26) |
| InChIKey | KCNHYRAECYSSGF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|