C23H19ClN2O3 — CID 51133842
6-chloro-3-[1-(3-methyl-1-benzofuran-2-carbonyl)piperidin-4-ylidene]-1H-indol-2-one (PubChem CID 51133842) has the molecular formula C23H19ClN2O3 and a molecular weight of 406.87 g/mol. Its IUPAC name is 6-chloro-3-[1-(3-methyl-1-benzofuran-2-carbonyl)piperidin-4-ylidene]-1H-indol-2-one.
| Compound Name | 6-chloro-3-[1-(3-methyl-1-benzofuran-2-carbonyl)piperidin-4-ylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 51133842 |
| Molecular Formula | C23H19ClN2O3 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 6-chloro-3-[1-(3-methyl-1-benzofuran-2-carbonyl)piperidin-4-ylidene]-1H-indol-2-one |
| SMILES | Cc1c(C(=O)N2CCC(=C3C(=O)Nc4cc(Cl)ccc43)CC2)oc2ccccc12 |
| InChI | InChI=1S/C23H19ClN2O3/c1-13-16-4-2-3-5-19(16)29-21(13)23(28)26-10-8-14(9-11-26)20-17-7-6-15(24)12-18(17)25-22(20)27/h2-7,12H,8-11H2,1H3,(H,25,27) |
| InChIKey | MAFZBVRNMRLJHF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|