C15H15ClN2O3 — CID 69259423
(4E)-4-(6-chloro-2-oxo-1H-indol-3-ylidene)azepane-1-carboxylic acid (PubChem CID 69259423) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is (4E)-4-(6-chloro-2-oxo-1H-indol-3-ylidene)azepane-1-carboxylic acid.
| Compound Name | (4E)-4-(6-chloro-2-oxo-1H-indol-3-ylidene)azepane-1-carboxylic acid |
|---|---|
| PubChem CID | 69259423 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (4E)-4-(6-chloro-2-oxo-1H-indol-3-ylidene)azepane-1-carboxylic acid |
| SMILES | O=C1Nc2cc(Cl)ccc2/C1=C1/CCCN(C(=O)O)CC1 |
| InChI | InChI=1S/C15H15ClN2O3/c16-10-3-4-11-12(8-10)17-14(19)13(11)9-2-1-6-18(7-5-9)15(20)21/h3-4,8H,1-2,5-7H2,(H,17,19)(H,20,21)/b13-9+ |
| InChIKey | GTWYPGPGNYWPPU-UKTHLTGXSA-N |
| XLogP | 3.21 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|