C14H12ClNO — CID 68796311
(3Z)-6-chloro-3-(cyclopenten-1-ylmethylidene)-1H-indol-2-one (PubChem CID 68796311) has the molecular formula C14H12ClNO and a molecular weight of 245.71 g/mol. Its IUPAC name is (3Z)-6-chloro-3-(cyclopenten-1-ylmethylidene)-1H-indol-2-one.
| Compound Name | (3Z)-6-chloro-3-(cyclopenten-1-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 68796311 |
| Molecular Formula | C14H12ClNO |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | (3Z)-6-chloro-3-(cyclopenten-1-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2/C1=C/C1=CCCC1 |
| InChI | InChI=1S/C14H12ClNO/c15-10-5-6-11-12(7-9-3-1-2-4-9)14(17)16-13(11)8-10/h3,5-8H,1-2,4H2,(H,16,17)/b12-7- |
| InChIKey | NKXRNQJXYKIYNA-GHXNOFRVSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|