C20H18ClFN2O3S — CID 51134045
6-chloro-3-[1-(3-fluoro-4-methylphenyl)sulfonylpiperidin-4-ylidene]-1H-indol-2-one (PubChem CID 51134045) has the molecular formula C20H18ClFN2O3S and a molecular weight of 420.89 g/mol. Its IUPAC name is 6-chloro-3-[1-(3-fluoro-4-methylphenyl)sulfonylpiperidin-4-ylidene]-1H-indol-2-one.
| Compound Name | 6-chloro-3-[1-(3-fluoro-4-methylphenyl)sulfonylpiperidin-4-ylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 51134045 |
| Molecular Formula | C20H18ClFN2O3S |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 6-chloro-3-[1-(3-fluoro-4-methylphenyl)sulfonylpiperidin-4-ylidene]-1H-indol-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(=C3C(=O)Nc4cc(Cl)ccc43)CC2)cc1F |
| InChI | InChI=1S/C20H18ClFN2O3S/c1-12-2-4-15(11-17(12)22)28(26,27)24-8-6-13(7-9-24)19-16-5-3-14(21)10-18(16)23-20(19)25/h2-5,10-11H,6-9H2,1H3,(H,23,25) |
| InChIKey | ZPUQDSGCEBXOCZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|