C12H20O4 — CID 51136325
4,5-dihydroxy-3-(hydroxymethyl)-2-pentylcyclohex-2-en-1-one (PubChem CID 51136325) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 4,5-dihydroxy-3-(hydroxymethyl)-2-pentylcyclohex-2-en-1-one.
| Compound Name | 4,5-dihydroxy-3-(hydroxymethyl)-2-pentylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 51136325 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4,5-dihydroxy-3-(hydroxymethyl)-2-pentylcyclohex-2-en-1-one |
| SMILES | CCCCCC1=C(CO)C(O)C(O)CC1=O |
| InChI | InChI=1S/C12H20O4/c1-2-3-4-5-8-9(7-13)12(16)11(15)6-10(8)14/h11-13,15-16H,2-7H2,1H3 |
| InChIKey | QYIFDJWMAKATAN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|