C12H22O4 — CID 170989053
(1R,2R,4S)-6-(hydroxymethyl)-5-pentylcyclohex-5-ene-1,2,4-triol (PubChem CID 170989053) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (1R,2R,4S)-6-(hydroxymethyl)-5-pentylcyclohex-5-ene-1,2,4-triol.
| Compound Name | (1R,2R,4S)-6-(hydroxymethyl)-5-pentylcyclohex-5-ene-1,2,4-triol |
|---|---|
| PubChem CID | 170989053 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (1R,2R,4S)-6-(hydroxymethyl)-5-pentylcyclohex-5-ene-1,2,4-triol |
| SMILES | CCCCCC1=C(CO)[C@@H](O)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C12H22O4/c1-2-3-4-5-8-9(7-13)12(16)11(15)6-10(8)14/h10-16H,2-7H2,1H3/t10-,11+,12+/m0/s1 |
| InChIKey | XUROSAIBLRQNMC-QJPTWQEYSA-N |
| XLogP | 0.34 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|