C16H20N2O3S — CID 51181607
N-[4-[methyl-[(3-methylthiophen-2-yl)methyl]amino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 51181607) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[4-[methyl-[(3-methylthiophen-2-yl)methyl]amino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[methyl-[(3-methylthiophen-2-yl)methyl]amino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51181607 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-[4-[methyl-[(3-methylthiophen-2-yl)methyl]amino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | Cc1ccsc1CN(C)C(=O)CCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C16H20N2O3S/c1-12-7-10-22-14(12)11-18(2)15(19)6-3-8-17-16(20)13-5-4-9-21-13/h4-5,7,9-10H,3,6,8,11H2,1-2H3,(H,17,20) |
| InChIKey | BIINWHNIHHLOOB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|