C21H18N4O3 — CID 51201676
N-methyl-2-oxo-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]chromene-3-carboxamide (PubChem CID 51201676) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-methyl-2-oxo-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]chromene-3-carboxamide.
| Compound Name | N-methyl-2-oxo-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 51201676 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-methyl-2-oxo-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]chromene-3-carboxamide |
| SMILES | CC(c1ccc(-n2cncn2)cc1)N(C)C(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C21H18N4O3/c1-14(15-7-9-17(10-8-15)25-13-22-12-23-25)24(2)20(26)18-11-16-5-3-4-6-19(16)28-21(18)27/h3-14H,1-2H3 |
| InChIKey | UCRVHKSAMFIELU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|