C18H25N3O3 — CID 512149
6-(4-Hexylanilino)-1-(2-hydroxyethyl)pyrimidine-2,4-dione (PubChem CID 512149) has the molecular formula C18H25N3O3 and a molecular weight of 331.40 g/mol. Its IUPAC name is 6-(4-hexylanilino)-1-(2-hydroxyethyl)pyrimidine-2,4-dione.
| Compound Name | 6-(4-Hexylanilino)-1-(2-hydroxyethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 512149 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 6-(4-hexylanilino)-1-(2-hydroxyethyl)pyrimidine-2,4-dione |
| SMILES | CCCCCCC1=CC=C(C=C1)NC2=CC(=O)NC(=O)N2CCO |
| InChI | InChI=1S/C18H25N3O3/c1-2-3-4-5-6-14-7-9-15(10-8-14)19-16-13-17(23)20-18(24)21(16)11-12-22/h7-10,13,19,22H,2-6,11-12H2,1H3,(H,20,23,24) |
| InChIKey | NPVGOZKIEBNNLS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | 456 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|