C21H23N5OS — CID 51217205
(4-methylpiperidin-1-yl)-[2-[(1-phenyltetrazol-5-yl)methylsulfanyl]phenyl]methanone (PubChem CID 51217205) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[2-[(1-phenyltetrazol-5-yl)methylsulfanyl]phenyl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[2-[(1-phenyltetrazol-5-yl)methylsulfanyl]phenyl]methanone |
|---|---|
| PubChem CID | 51217205 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[2-[(1-phenyltetrazol-5-yl)methylsulfanyl]phenyl]methanone |
| SMILES | CC1CCN(C(=O)c2ccccc2SCc2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N5OS/c1-16-11-13-25(14-12-16)21(27)18-9-5-6-10-19(18)28-15-20-22-23-24-26(20)17-7-3-2-4-8-17/h2-10,16H,11-15H2,1H3 |
| InChIKey | REBRYDKYWACVBP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |