C22H22FN3O3S — CID 5123263
N-(4-ethoxyphenyl)-2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazinane-6-carboxamide (PubChem CID 5123263) has the molecular formula C22H22FN3O3S and a molecular weight of 427.50 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 5123263 |
| Molecular Formula | C22H22FN3O3S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazinane-6-carboxamide |
| SMILES | C=CCN1C(=O)CC(C(=O)Nc2ccc(OCC)cc2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FN3O3S/c1-3-13-26-20(27)14-19(30-22(26)25-17-7-5-15(23)6-8-17)21(28)24-16-9-11-18(12-10-16)29-4-2/h3,5-12,19H,1,4,13-14H2,2H3,(H,24,28)/b25-22- |
| InChIKey | PTHJOUVCLUOWAN-LVWGJNHUSA-N |
| XLogP | 4.37 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|