C20H17BrFN3O2S — CID 51388351
(6R)-N-(4-bromophenyl)-2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazinane-6-carboxamide (PubChem CID 51388351) has the molecular formula C20H17BrFN3O2S and a molecular weight of 462.34 g/mol. Its IUPAC name is (6R)-N-(4-bromophenyl)-2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazinane-6-carboxamide.
| Compound Name | (6R)-N-(4-bromophenyl)-2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 51388351 |
| Molecular Formula | C20H17BrFN3O2S |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | (6R)-N-(4-bromophenyl)-2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazinane-6-carboxamide |
| SMILES | C=CCN1C(=O)C[C@H](C(=O)Nc2ccc(Br)cc2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17BrFN3O2S/c1-2-11-25-18(26)12-17(19(27)23-15-7-3-13(21)4-8-15)28-20(25)24-16-9-5-14(22)6-10-16/h2-10,17H,1,11-12H2,(H,23,27)/b24-20-/t17-/m1/s1 |
| InChIKey | NBTMDLCRUCGGRT-BJUXRVGASA-N |
| XLogP | 4.73 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|