C18H20N2O2 — CID 51238799
N'-ethyl-N'-(4-methylphenyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide (PubChem CID 51238799) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N'-ethyl-N'-(4-methylphenyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-ethyl-N'-(4-methylphenyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 51238799 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N'-ethyl-N'-(4-methylphenyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide |
| SMILES | CCN(NC(=O)C1Cc2ccccc2O1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20N2O2/c1-3-20(15-10-8-13(2)9-11-15)19-18(21)17-12-14-6-4-5-7-16(14)22-17/h4-11,17H,3,12H2,1-2H3,(H,19,21) |
| InChIKey | PEWVQJNHSCSNHL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|