C17H21FN2O3S — CID 51241659
N-[2-(2-fluorophenoxy)ethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 51241659) has the molecular formula C17H21FN2O3S and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)ethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-[2-(2-fluorophenoxy)ethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 51241659 |
| Molecular Formula | C17H21FN2O3S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-[2-(2-fluorophenoxy)ethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CN(CCOc1ccccc1F)C(=O)C1CSC2(C)CCC(=O)N12 |
| InChI | InChI=1S/C17H21FN2O3S/c1-17-8-7-15(21)20(17)13(11-24-17)16(22)19(2)9-10-23-14-6-4-3-5-12(14)18/h3-6,13H,7-11H2,1-2H3 |
| InChIKey | JPHXOSMPDSQTGE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |