C20H23ClN4O3 — CID 5127366
4-[[[2-[4-[(2-chlorophenyl)methyl]piperazin-1-ium-1-yl]acetyl]hydrazinylidene]methyl]-2-hydroxyphenolate (PubChem CID 5127366) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is 4-[[[2-[4-[(2-chlorophenyl)methyl]piperazin-1-ium-1-yl]acetyl]hydrazinylidene]methyl]-2-hydroxyphenolate.
| Compound Name | 4-[[[2-[4-[(2-chlorophenyl)methyl]piperazin-1-ium-1-yl]acetyl]hydrazinylidene]methyl]-2-hydroxyphenolate |
|---|---|
| PubChem CID | 5127366 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 4-[[[2-[4-[(2-chlorophenyl)methyl]piperazin-1-ium-1-yl]acetyl]hydrazinylidene]methyl]-2-hydroxyphenolate |
| SMILES | O=C(C[NH+]1CCN(Cc2ccccc2Cl)CC1)NN=Cc1ccc([O-])c(O)c1 |
| InChI | InChI=1S/C20H23ClN4O3/c21-17-4-2-1-3-16(17)13-24-7-9-25(10-8-24)14-20(28)23-22-12-15-5-6-18(26)19(27)11-15/h1-6,11-12,26-27H,7-10,13-14H2,(H,23,28) |
| InChIKey | PQIXWVZJFSWYDG-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|