C22H26N2O4 — CID 51273775
N-[2-(2,3-dihydro-1H-inden-1-ylamino)-2-oxoethyl]-3,4-diethoxybenzamide (PubChem CID 51273775) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-inden-1-ylamino)-2-oxoethyl]-3,4-diethoxybenzamide.
| Compound Name | N-[2-(2,3-dihydro-1H-inden-1-ylamino)-2-oxoethyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 51273775 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-inden-1-ylamino)-2-oxoethyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)NC2CCc3ccccc32)cc1OCC |
| InChI | InChI=1S/C22H26N2O4/c1-3-27-19-12-10-16(13-20(19)28-4-2)22(26)23-14-21(25)24-18-11-9-15-7-5-6-8-17(15)18/h5-8,10,12-13,18H,3-4,9,11,14H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | LRDLOYMYXLRNQE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |