C14H23NO4S2 — CID 51284641
N-butyl-N-ethyl-2,4-bis(methylsulfonyl)aniline (PubChem CID 51284641) has the molecular formula C14H23NO4S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is N-butyl-N-ethyl-2,4-bis(methylsulfonyl)aniline.
| Compound Name | N-butyl-N-ethyl-2,4-bis(methylsulfonyl)aniline |
|---|---|
| PubChem CID | 51284641 |
| Molecular Formula | C14H23NO4S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-butyl-N-ethyl-2,4-bis(methylsulfonyl)aniline |
| SMILES | CCCCN(CC)c1ccc(S(C)(=O)=O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C14H23NO4S2/c1-5-7-10-15(6-2)13-9-8-12(20(3,16)17)11-14(13)21(4,18)19/h8-9,11H,5-7,10H2,1-4H3 |
| InChIKey | HVPWJUZSYSJAFV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |