C17H21NO4S2 — CID 17424726
N-methyl-N-[(4-methylphenyl)methyl]-2,4-bis(methylsulfonyl)aniline (PubChem CID 17424726) has the molecular formula C17H21NO4S2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-methyl-N-[(4-methylphenyl)methyl]-2,4-bis(methylsulfonyl)aniline.
| Compound Name | N-methyl-N-[(4-methylphenyl)methyl]-2,4-bis(methylsulfonyl)aniline |
|---|---|
| PubChem CID | 17424726 |
| Molecular Formula | C17H21NO4S2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-methyl-N-[(4-methylphenyl)methyl]-2,4-bis(methylsulfonyl)aniline |
| SMILES | Cc1ccc(CN(C)c2ccc(S(C)(=O)=O)cc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H21NO4S2/c1-13-5-7-14(8-6-13)12-18(2)16-10-9-15(23(3,19)20)11-17(16)24(4,21)22/h5-11H,12H2,1-4H3 |
| InChIKey | ZTIBBKNTABJCHJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |