C18H23BrN2O3 — CID 51293210
[1-(4-bromobenzoyl)piperidin-4-yl]-(2-methylmorpholin-4-yl)methanone (PubChem CID 51293210) has the molecular formula C18H23BrN2O3 and a molecular weight of 395.30 g/mol. Its IUPAC name is [1-(4-bromobenzoyl)piperidin-4-yl]-(2-methylmorpholin-4-yl)methanone.
| Compound Name | [1-(4-bromobenzoyl)piperidin-4-yl]-(2-methylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 51293210 |
| Molecular Formula | C18H23BrN2O3 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | [1-(4-bromobenzoyl)piperidin-4-yl]-(2-methylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)C2CCN(C(=O)c3ccc(Br)cc3)CC2)CCO1 |
| InChI | InChI=1S/C18H23BrN2O3/c1-13-12-21(10-11-24-13)18(23)15-6-8-20(9-7-15)17(22)14-2-4-16(19)5-3-14/h2-5,13,15H,6-12H2,1H3 |
| InChIKey | RHWKPVUUNVNUGY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |