C22H24N4O5S3 — CID 5133240
2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 5133240) has the molecular formula C22H24N4O5S3 and a molecular weight of 520.66 g/mol. Its IUPAC name is 2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 5133240 |
| Molecular Formula | C22H24N4O5S3 |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | C=CCSc1nnc(NC(=O)COc2ccc(N(C)S(=O)(=O)c3ccc(OCC)cc3)cc2)s1 |
| InChI | InChI=1S/C22H24N4O5S3/c1-4-14-32-22-25-24-21(33-22)23-20(27)15-31-18-8-6-16(7-9-18)26(3)34(28,29)19-12-10-17(11-13-19)30-5-2/h4,6-13H,1,5,14-15H2,2-3H3,(H,23,24,27) |
| InChIKey | MJGDHLFQHFLPKY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|