About 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene
2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene (PubChem CID 51345842) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene.
Analyze 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene?
The IUPAC name of 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene (CID 51345842) is 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene.
What is the SMILES notation for 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene?
The canonical SMILES for 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene is c1cn2c3c(nc2cn1)CCCCC3.
What is the InChIKey of 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene?
The InChIKey is ZWEXHLVGQVARDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c1-2-4-9-10(5-3-1)14-7-6-12-8-11(14)13-9/h6-8H,1-5H2.
What are the key properties of 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene?
2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene has a molecular weight of 187.25 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraene is sourced from PubChem (CID 51345842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).