C28H31ClFN5O — CID 51346889
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-methyl-5-[(4-pent-4-ynylpiperazin-1-yl)methyl]pyrimidin-4-amine (PubChem CID 51346889) has the molecular formula C28H31ClFN5O and a molecular weight of 508.04 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-methyl-5-[(4-pent-4-ynylpiperazin-1-yl)methyl]pyrimidin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-methyl-5-[(4-pent-4-ynylpiperazin-1-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 51346889 |
| Molecular Formula | C28H31ClFN5O |
| Molecular Weight | 508.04 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-methyl-5-[(4-pent-4-ynylpiperazin-1-yl)methyl]pyrimidin-4-amine |
| SMILES | C#CCCCN1CCN(Cc2c(C)ncnc2Nc2ccc(OCc3cccc(F)c3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C28H31ClFN5O/c1-3-4-5-11-34-12-14-35(15-13-34)18-25-21(2)31-20-32-28(25)33-24-9-10-27(26(29)17-24)36-19-22-7-6-8-23(30)16-22/h1,6-10,16-17,20H,4-5,11-15,18-19H2,2H3,(H,31,32,33) |
| InChIKey | UODDPXBPMSLLMC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.04 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|