C31H22IN3O2S — CID 51349960
3-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]chromen-2-one iodide (PubChem CID 51349960) has the molecular formula C31H22IN3O2S and a molecular weight of 627.51 g/mol. Its IUPAC name is 3-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]chromen-2-one iodide.
| Compound Name | 3-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]chromen-2-one iodide |
|---|---|
| PubChem CID | 51349960 |
| Molecular Formula | C31H22IN3O2S |
| Molecular Weight | 627.51 g/mol |
| Exact Mass | 627.05 |
| IUPAC Name | 3-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]chromen-2-one iodide |
| SMILES | CC[n+]1c(-c2cc3ccccc3oc2=O)n(-c2ccccc2)c2ccc(-c3nc4ccccc4s3)cc21.[I-] |
| InChI | InChI=1S/C31H22N3O2S.HI/c1-2-33-26-19-21(29-32-24-13-7-9-15-28(24)37-29)16-17-25(26)34(22-11-4-3-5-12-22)30(33)23-18-20-10-6-8-14-27(20)36-31(23)35;/h3-19H,2H2,1H3;1H/q+1;/p-1 |
| InChIKey | DGCNHFREUWJUDG-UHFFFAOYSA-M |
| XLogP | 3.99 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|