C46H98O8Si5 — CID 51354254
[(2R,3R,4R,5R)-2,3,4,5,6-pentakis(triethylsilyloxy)hexyl] (2E,4S,5S)-5-hydroxy-2,4,6-trimethylhepta-2,6-dienoate (PubChem CID 51354254) has the molecular formula C46H98O8Si5 and a molecular weight of 919.71 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,3,4,5,6-pentakis(triethylsilyloxy)hexyl] (2E,4S,5S)-5-hydroxy-2,4,6-trimethylhepta-2,6-dienoate.
| Compound Name | [(2R,3R,4R,5R)-2,3,4,5,6-pentakis(triethylsilyloxy)hexyl] (2E,4S,5S)-5-hydroxy-2,4,6-trimethylhepta-2,6-dienoate |
|---|---|
| PubChem CID | 51354254 |
| Molecular Formula | C46H98O8Si5 |
| Molecular Weight | 919.71 g/mol |
| Exact Mass | 918.61 |
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5,6-pentakis(triethylsilyloxy)hexyl] (2E,4S,5S)-5-hydroxy-2,4,6-trimethylhepta-2,6-dienoate |
| SMILES | C=C(C)[C@@H](O)[C@@H](C)/C=C(\C)C(=O)OC[C@@H](O[Si](CC)(CC)CC)[C@@H](O[Si](CC)(CC)CC)[C@H](O[Si](CC)(CC)CC)[C@@H](CO[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C46H98O8Si5/c1-20-55(21-2,22-3)50-37-42(52-57(26-7,27-8)28-9)45(54-59(32-13,33-14)34-15)44(53-58(29-10,30-11)31-12)41(51-56(23-4,24-5)25-6)36-49-46(48)40(19)35-39(18)43(47)38(16)17/h35,39,41-45,47H,16,20-34,36-37H2,1-15,17-19H3/b40-35+/t39-,41+,42+,43+,44+,45+/m0/s1 |
| InChIKey | OAPOPOSSDPIPDH-ONRVXPAASA-N |
| XLogP | 13.63 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.71 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|